C15H22N2O — CID 82750432
(1R)-1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-pyridinyl]ethanol (PubChem CID 82750432) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (1R)-1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-pyridinyl]ethanol.
| Compound Name | (1R)-1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-pyridinyl]ethanol |
|---|---|
| PubChem CID | 82750432 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1R)-1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-pyridinyl]ethanol |
| SMILES | C[C@@H](O)c1ccnc(N2CCC3CCCCC32)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11(18)13-6-8-16-15(10-13)17-9-7-12-4-2-3-5-14(12)17/h6,8,10-12,14,18H,2-5,7,9H2,1H3/t11-,12?,14?/m1/s1 |
| InChIKey | LXYIJJVOBAKCRC-LKSINWNRSA-N |
| XLogP | 2.90 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |