C15H19BrFN — CID 82750472
1-[(3-bromo-4-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82750472) has the molecular formula C15H19BrFN and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82750472 |
| Molecular Formula | C15H19BrFN |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Fc1ccc(CN2CCC3CCCCC32)cc1Br |
| InChI | InChI=1S/C15H19BrFN/c16-13-9-11(5-6-14(13)17)10-18-8-7-12-3-1-2-4-15(12)18/h5-6,9,12,15H,1-4,7-8,10H2 |
| InChIKey | MRKCBGSLNULRJH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |