C12H16FN3 — CID 82750561
1-(6-fluoropyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82750561) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-(6-fluoropyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(6-fluoropyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82750561 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 1-(6-fluoropyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Fc1cc(N2CCC3CCCCC32)ncn1 |
| InChI | InChI=1S/C12H16FN3/c13-11-7-12(15-8-14-11)16-6-5-9-3-1-2-4-10(9)16/h7-10H,1-6H2 |
| InChIKey | NZHRYKMGXKGXHC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |