C14H23NO2 — CID 82751163
ethyl (E)-4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)but-2-enoate (PubChem CID 82751163) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is ethyl (E)-4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 82751163 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethyl (E)-4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1CCC2CCCCC21 |
| InChI | InChI=1S/C14H23NO2/c1-2-17-14(16)8-5-10-15-11-9-12-6-3-4-7-13(12)15/h5,8,12-13H,2-4,6-7,9-11H2,1H3/b8-5+ |
| InChIKey | PSSKJUCXRTZXRV-VMPITWQZSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|