C18H34N2O — CID 82751348
N-[[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxolan-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 82751348) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is N-[[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxolan-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxolan-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 82751348 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | N-[[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxolan-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1CCC(CN2CCC3CCCCC32)O1 |
| InChI | InChI=1S/C18H34N2O/c1-14(2)11-19-12-16-7-8-17(21-16)13-20-10-9-15-5-3-4-6-18(15)20/h14-19H,3-13H2,1-2H3 |
| InChIKey | MYXMYSKKHJKIEV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |