C15H26N6 — CID 82751548
6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 82751548) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 82751548 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C15H26N6/c1-3-20(4-2)14-17-13(16)18-15(19-14)21-10-9-11-7-5-6-8-12(11)21/h11-12H,3-10H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | FWOVJUJTUHIFHL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |