C15H22N6 — CID 82751584
2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]-6-hydrazinyl-5-methylpyrimidin-4-amine (PubChem CID 82751584) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]-6-hydrazinyl-5-methylpyrimidin-4-amine.
| Compound Name | 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]-6-hydrazinyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82751584 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]-6-hydrazinyl-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(NN)c(C)c(NCc2ncccc2CC)n1 |
| InChI | InChI=1S/C15H22N6/c1-4-11-7-6-8-17-12(11)9-18-14-10(3)15(21-16)20-13(5-2)19-14/h6-8H,4-5,9,16H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | YFJVWVXZALSJCL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|