C15H24N6 — CID 82752006
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 82752006) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82752006 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCCC2)nc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C15H24N6/c16-13-17-14(20-8-3-4-9-20)19-15(18-13)21-10-7-11-5-1-2-6-12(11)21/h11-12H,1-10H2,(H2,16,17,18,19) |
| InChIKey | JFIWVEJAFKLFRK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |