C18H26N2 — CID 82752059
[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-dihydroinden-2-yl]methanamine (PubChem CID 82752059) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-dihydroinden-2-yl]methanamine.
| Compound Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-dihydroinden-2-yl]methanamine |
|---|---|
| PubChem CID | 82752059 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-dihydroinden-2-yl]methanamine |
| SMILES | NCC1(N2CCC3CCCCC32)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H26N2/c19-13-18(11-15-6-1-2-7-16(15)12-18)20-10-9-14-5-3-4-8-17(14)20/h1-2,6-7,14,17H,3-5,8-13,19H2 |
| InChIKey | VEJNGZSNJUCOOW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |