C14H18ClN3O — CID 82752072
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(6-amino-3-chloro-2-pyridinyl)methanone (PubChem CID 82752072) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(6-amino-3-chloro-2-pyridinyl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(6-amino-3-chloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 82752072 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(6-amino-3-chloro-2-pyridinyl)methanone |
| SMILES | Nc1ccc(Cl)c(C(=O)N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C14H18ClN3O/c15-10-5-6-12(16)17-13(10)14(19)18-8-7-9-3-1-2-4-11(9)18/h5-6,9,11H,1-4,7-8H2,(H2,16,17) |
| InChIKey | DNJCKZKGVXPSPH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |