C18H24N2O — CID 82752187
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1-benzofuran-3-yl)ethanamine (PubChem CID 82752187) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1-benzofuran-3-yl)ethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1-benzofuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 82752187 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1-benzofuran-3-yl)ethanamine |
| SMILES | NCC(c1coc2ccccc12)N1CCC2CCCCC21 |
| InChI | InChI=1S/C18H24N2O/c19-11-17(15-12-21-18-8-4-2-6-14(15)18)20-10-9-13-5-1-3-7-16(13)20/h2,4,6,8,12-13,16-17H,1,3,5,7,9-11,19H2 |
| InChIKey | SPJGUHSXXWVROO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |