C16H18F3NO — CID 82752765
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(trifluoromethyl)benzaldehyde (PubChem CID 82752765) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 82752765 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CCC3CCCCC32)cc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO/c17-16(18,19)14-9-13(6-5-12(14)10-21)20-8-7-11-3-1-2-4-15(11)20/h5-6,9-11,15H,1-4,7-8H2 |
| InChIKey | BQGPMAWEPJAQIY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|