C18H25NO2 — CID 82752898
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(4-ethoxyphenyl)ethanone (PubChem CID 82752898) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(4-ethoxyphenyl)ethanone.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82752898 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(C(=O)CN2CCC3CCCCC32)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-2-21-16-9-7-15(8-10-16)18(20)13-19-12-11-14-5-3-4-6-17(14)19/h7-10,14,17H,2-6,11-13H2,1H3 |
| InChIKey | OQJUHKYQMITDJX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |