C18H27FN2 — CID 82753152
1-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-fluorophenyl]butan-2-amine (PubChem CID 82753152) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-fluorophenyl]butan-2-amine.
| Compound Name | 1-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-fluorophenyl]butan-2-amine |
|---|---|
| PubChem CID | 82753152 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-fluorophenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(N2CCC3CCCCC32)c(F)c1 |
| InChI | InChI=1S/C18H27FN2/c1-2-15(20)11-13-7-8-18(16(19)12-13)21-10-9-14-5-3-4-6-17(14)21/h7-8,12,14-15,17H,2-6,9-11,20H2,1H3 |
| InChIKey | XUSCTZLFSCVFRA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |