C14H23N3O4 — CID 82753203
(2S)-2-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonylamino)-5-amino-5-oxopentanoic acid (PubChem CID 82753203) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S)-2-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonylamino)-5-amino-5-oxopentanoic acid.
| Compound Name | (2S)-2-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonylamino)-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82753203 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S)-2-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonylamino)-5-amino-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)N1CCC2CCCCC21)C(=O)O |
| InChI | InChI=1S/C14H23N3O4/c15-12(18)6-5-10(13(19)20)16-14(21)17-8-7-9-3-1-2-4-11(9)17/h9-11H,1-8H2,(H2,15,18)(H,16,21)(H,19,20)/t9?,10-,11?/m0/s1 |
| InChIKey | YPAUDIKBBBIGES-YVNMAJEFSA-N |
| XLogP | 0.68 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |