C18H22N2O — CID 82753365
[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)quinolin-2-yl]methanol (PubChem CID 82753365) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)quinolin-2-yl]methanol.
| Compound Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 82753365 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)quinolin-2-yl]methanol |
| SMILES | OCc1cc(N2CCC3CCCCC32)c2ccccc2n1 |
| InChI | InChI=1S/C18H22N2O/c21-12-14-11-18(15-6-2-3-7-16(15)19-14)20-10-9-13-5-1-4-8-17(13)20/h2-3,6-7,11,13,17,21H,1,4-5,8-10,12H2 |
| InChIKey | MUVCCRWLTYJVDH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |