C14H21N3O2S — CID 82753381
3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-N-methylpyridin-2-amine (PubChem CID 82753381) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-N-methylpyridin-2-amine.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 82753381 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-N-methylpyridin-2-amine |
| SMILES | CNc1ncccc1S(=O)(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C14H21N3O2S/c1-15-14-13(7-4-9-16-14)20(18,19)17-10-8-11-5-2-3-6-12(11)17/h4,7,9,11-12H,2-3,5-6,8,10H2,1H3,(H,15,16) |
| InChIKey | JKRRTQIKYMEDOY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |