C14H30N2O2 — CID 82754362
N-(4-ethoxybutyl)-N'-methyl-N'-(2-methyloxolan-3-yl)ethane-1,2-diamine (PubChem CID 82754362) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-(4-ethoxybutyl)-N'-methyl-N'-(2-methyloxolan-3-yl)ethane-1,2-diamine.
| Compound Name | N-(4-ethoxybutyl)-N'-methyl-N'-(2-methyloxolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82754362 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | N-(4-ethoxybutyl)-N'-methyl-N'-(2-methyloxolan-3-yl)ethane-1,2-diamine |
| SMILES | CCOCCCCNCCN(C)C1CCOC1C |
| InChI | InChI=1S/C14H30N2O2/c1-4-17-11-6-5-8-15-9-10-16(3)14-7-12-18-13(14)2/h13-15H,4-12H2,1-3H3 |
| InChIKey | ANBFBODXKKLDRJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|