C13H18N2O3 — CID 82755155
(2-hydroxy-4-methoxyphenyl)-[(2R)-2-methylpiperazin-1-yl]methanone (PubChem CID 82755155) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl)-[(2R)-2-methylpiperazin-1-yl]methanone.
| Compound Name | (2-hydroxy-4-methoxyphenyl)-[(2R)-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 82755155 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-[(2R)-2-methylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCNC[C@H]2C)c(O)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-9-8-14-5-6-15(9)13(17)11-4-3-10(18-2)7-12(11)16/h3-4,7,9,14,16H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | XVFVRTWQTAHEFT-SECBINFHSA-N |
| XLogP | 0.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |