C9H18N2O2 — CID 82755213
3-[(2S)-2-methylpiperazin-1-yl]butanoic acid (PubChem CID 82755213) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-[(2S)-2-methylpiperazin-1-yl]butanoic acid.
| Compound Name | 3-[(2S)-2-methylpiperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82755213 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-[(2S)-2-methylpiperazin-1-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1CCNC[C@@H]1C |
| InChI | InChI=1S/C9H18N2O2/c1-7(5-9(12)13)11-4-3-10-6-8(11)2/h7-8,10H,3-6H2,1-2H3,(H,12,13)/t7?,8-/m0/s1 |
| InChIKey | OFXIYPFYDHQGTR-MQWKRIRWSA-N |
| XLogP | 0.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |