About (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine
(2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine (PubChem CID 82756199) has the molecular formula C9H17F3N2
and a molecular weight of 210.24 g/mol. Its IUPAC name is (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine.
Molecular Properties
| Compound Name | (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine |
| PubChem CID | 82756199 |
| Molecular Formula | C9H17F3N2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine |
| SMILES | C[C@H]1CNCCN1CCCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2/c1-8-7-13-4-6-14(8)5-2-3-9(10,11)12/h8,13H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | CRJHMVPRFRAGCJ-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine?
The IUPAC name of (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine (CID 82756199) is (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine.
What is the SMILES notation for (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine?
The canonical SMILES for (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine is C[C@H]1CNCCN1CCCC(F)(F)F.
What is the InChIKey of (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine?
The InChIKey is CRJHMVPRFRAGCJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H17F3N2/c1-8-7-13-4-6-14(8)5-2-3-9(10,11)12/h8,13H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine?
(2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine has a molecular weight of 210.24 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-1-(4,4,4-trifluorobutyl)piperazine is sourced from PubChem (CID 82756199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).