C14H10BrCl2NO — CID 82756818
N-(2-bromo-5-methylphenyl)-2,6-dichlorobenzamide (PubChem CID 82756818) has the molecular formula C14H10BrCl2NO and a molecular weight of 359.05 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-2,6-dichlorobenzamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 82756818 |
| Molecular Formula | C14H10BrCl2NO |
| Molecular Weight | 359.05 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-2,6-dichlorobenzamide |
| SMILES | Cc1ccc(Br)c(NC(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H10BrCl2NO/c1-8-5-6-9(15)12(7-8)18-14(19)13-10(16)3-2-4-11(13)17/h2-7H,1H3,(H,18,19) |
| InChIKey | KOQJBHAGUDZAPD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.05 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |