About 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline
2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline (PubChem CID 82756944) has the molecular formula C16H15BrClNO
and a molecular weight of 352.66 g/mol. Its IUPAC name is 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline.
Molecular Properties
| Compound Name | 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline |
| PubChem CID | 82756944 |
| Molecular Formula | C16H15BrClNO |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline |
| SMILES | Cc1ccc(Br)c(NCC2Cc3cc(Cl)ccc3O2)c1 |
| InChI | InChI=1S/C16H15BrClNO/c1-10-2-4-14(17)15(6-10)19-9-13-8-11-7-12(18)3-5-16(11)20-13/h2-7,13,19H,8-9H2,1H3 |
| InChIKey | QXKLWGGYBZYGLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline?
The IUPAC name of 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline (CID 82756944) is 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline.
What is the SMILES notation for 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline?
The canonical SMILES for 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline is Cc1ccc(Br)c(NCC2Cc3cc(Cl)ccc3O2)c1.
What is the InChIKey of 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline?
The InChIKey is QXKLWGGYBZYGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrClNO/c1-10-2-4-14(17)15(6-10)19-9-13-8-11-7-12(18)3-5-16(11)20-13/h2-7,13,19H,8-9H2,1H3.
What are the key properties of 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline?
2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline has a molecular weight of 352.66 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-5-methylaniline is sourced from PubChem (CID 82756944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).