About 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine
3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 82757178) has the molecular formula C12H17BrN2O2S
and a molecular weight of 333.25 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 82757178 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | Cc1ccc(Br)c(NC2(CN)CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-9-2-3-10(13)11(6-9)15-12(7-14)4-5-18(16,17)8-12/h2-3,6,15H,4-5,7-8,14H2,1H3 |
| InChIKey | MJTCDEJZYLYUHE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine (CID 82757178) is 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine is Cc1ccc(Br)c(NC2(CN)CCS(=O)(=O)C2)c1.
What is the InChIKey of 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine?
The InChIKey is MJTCDEJZYLYUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O2S/c1-9-2-3-10(13)11(6-9)15-12(7-14)4-5-18(16,17)8-12/h2-3,6,15H,4-5,7-8,14H2,1H3.
What are the key properties of 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine?
3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine has a molecular weight of 333.25 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N-(2-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 82757178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).