About 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one
5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one (PubChem CID 82758114) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one |
| PubChem CID | 82758114 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one |
| SMILES | C[C@@H](N)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c1-7(13)8-4-5-10-9(6-8)12(2,3)11(15)14-10/h4-7H,13H2,1-3H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | ILNOSMSMOLVXDJ-SSDOTTSWSA-N |
| XLogP | 1.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one?
The IUPAC name of 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one (CID 82758114) is 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one.
What is the SMILES notation for 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one?
The canonical SMILES for 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one is C[C@@H](N)c1ccc2c(c1)C(C)(C)C(=O)N2.
What is the InChIKey of 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one?
The InChIKey is ILNOSMSMOLVXDJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H16N2O/c1-7(13)8-4-5-10-9(6-8)12(2,3)11(15)14-10/h4-7H,13H2,1-3H3,(H,14,15)/t7-/m1/s1.
What are the key properties of 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one?
5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one has a molecular weight of 204.27 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-aminoethyl]-3,3-dimethyl-1H-indol-2-one is sourced from PubChem (CID 82758114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).