C16H23ClN2O — CID 82758766
N-[(2-chloro-1-benzofuran-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 82758766) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(2-chloro-1-benzofuran-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82758766 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1c(Cl)oc2ccccc12 |
| InChI | InChI=1S/C16H23ClN2O/c1-3-19(4-2)11-7-10-18-12-14-13-8-5-6-9-15(13)20-16(14)17/h5-6,8-9,18H,3-4,7,10-12H2,1-2H3 |
| InChIKey | DAUSEBNMQDSTKG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|