C17H33NO — CID 82759904
N-(3,5-dimethylcyclohexyl)-2,2-diethyloxan-4-amine (PubChem CID 82759904) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-2,2-diethyloxan-4-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-2,2-diethyloxan-4-amine |
|---|---|
| PubChem CID | 82759904 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NC2CC(C)CC(C)C2)CCO1 |
| InChI | InChI=1S/C17H33NO/c1-5-17(6-2)12-15(7-8-19-17)18-16-10-13(3)9-14(4)11-16/h13-16,18H,5-12H2,1-4H3 |
| InChIKey | LXFZHHOEBPPQHD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |