C12H20F3NO3 — CID 82760710
2,2,2-trifluoroethyl N-(2,2-diethyloxan-4-yl)carbamate (PubChem CID 82760710) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2,2-diethyloxan-4-yl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2,2-diethyloxan-4-yl)carbamate |
|---|---|
| PubChem CID | 82760710 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2,2-diethyloxan-4-yl)carbamate |
| SMILES | CCC1(CC)CC(NC(=O)OCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C12H20F3NO3/c1-3-11(4-2)7-9(5-6-19-11)16-10(17)18-8-12(13,14)15/h9H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | OTVXMFRUESCDLV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |