C22H19FN2O — CID 827608
N-[1-(4-fluorophenyl)ethylideneamino]-2,2-diphenylacetamide (PubChem CID 827608) has the molecular formula C22H19FN2O and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[1-(4-fluorophenyl)ethylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 827608 |
| Molecular Formula | C22H19FN2O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethylideneamino]-2,2-diphenylacetamide |
| SMILES | CC(=NNC(=O)C(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN2O/c1-16(17-12-14-20(23)15-13-17)24-25-22(26)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,21H,1H3,(H,25,26) |
| InChIKey | VLIDYWTXWVQBOS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|