C11H25N3 — CID 82760939
N,N-diethyl-2-[(2R)-2-methylpiperazin-1-yl]ethanamine (PubChem CID 82760939) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N,N-diethyl-2-[(2R)-2-methylpiperazin-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[(2R)-2-methylpiperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 82760939 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N,N-diethyl-2-[(2R)-2-methylpiperazin-1-yl]ethanamine |
| SMILES | CCN(CC)CCN1CCNC[C@H]1C |
| InChI | InChI=1S/C11H25N3/c1-4-13(5-2)8-9-14-7-6-12-10-11(14)3/h11-12H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | KFBCEBZTXSNDFB-LLVKDONJSA-N |
| XLogP | 0.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |