C13H17BrN2 — CID 82765251
7-bromo-3a-methyl-2,3,4,5,10,10a-hexahydro-1H-cyclopenta[b][1,5]benzodiazepine (PubChem CID 82765251) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 7-bromo-3a-methyl-2,3,4,5,10,10a-hexahydro-1H-cyclopenta[b][1,5]benzodiazepine.
| Compound Name | 7-bromo-3a-methyl-2,3,4,5,10,10a-hexahydro-1H-cyclopenta[b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 82765251 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 7-bromo-3a-methyl-2,3,4,5,10,10a-hexahydro-1H-cyclopenta[b][1,5]benzodiazepine |
| SMILES | CC12CCCC1Nc1ccc(Br)cc1NC2 |
| InChI | InChI=1S/C13H17BrN2/c1-13-6-2-3-12(13)16-10-5-4-9(14)7-11(10)15-8-13/h4-5,7,12,15-16H,2-3,6,8H2,1H3 |
| InChIKey | PZWLXSIJGWWTDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |