C13H17N3O — CID 82765563
7,12-dimethyl-2,9,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-8-one (PubChem CID 82765563) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 7,12-dimethyl-2,9,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-8-one.
| Compound Name | 7,12-dimethyl-2,9,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-8-one |
|---|---|
| PubChem CID | 82765563 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 7,12-dimethyl-2,9,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-8-one |
| SMILES | Cc1cnc2c(c1)NC(=O)C1(C)CCCC1N2 |
| InChI | InChI=1S/C13H17N3O/c1-8-6-9-11(14-7-8)16-10-4-3-5-13(10,2)12(17)15-9/h6-7,10H,3-5H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | ZVYSIADQSGETTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |