C13H17FN2O — CID 82765588
2-amino-N-(3-fluorophenyl)-1-methylcyclopentane-1-carboxamide (PubChem CID 82765588) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-amino-N-(3-fluorophenyl)-1-methylcyclopentane-1-carboxamide.
| Compound Name | 2-amino-N-(3-fluorophenyl)-1-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 82765588 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-amino-N-(3-fluorophenyl)-1-methylcyclopentane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(F)c2)CCCC1N |
| InChI | InChI=1S/C13H17FN2O/c1-13(7-3-6-11(13)15)12(17)16-10-5-2-4-9(14)8-10/h2,4-5,8,11H,3,6-7,15H2,1H3,(H,16,17) |
| InChIKey | SXBFDXGDEKCXDS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |