C15H15N3O2 — CID 82766354
N-[2-(3-aminoprop-1-ynyl)-5-methylphenyl]-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 82766354) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-5-methylphenyl]-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-5-methylphenyl]-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 82766354 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-5-methylphenyl]-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ccc(C#CCN)c(NC(=O)c2ocnc2C)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-5-6-12(4-3-7-16)13(8-10)18-15(19)14-11(2)17-9-20-14/h5-6,8-9H,7,16H2,1-2H3,(H,18,19) |
| InChIKey | TYBUHFAXRXGSTH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|