About 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline
8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline (PubChem CID 82766418) has the molecular formula C12H8BrClF3N
and a molecular weight of 338.55 g/mol. Its IUPAC name is 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline |
| PubChem CID | 82766418 |
| Molecular Formula | C12H8BrClF3N |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline |
| SMILES | Cc1c(C(F)(F)F)nc2c(Br)ccc(C)c2c1Cl |
| InChI | InChI=1S/C12H8BrClF3N/c1-5-3-4-7(13)10-8(5)9(14)6(2)11(18-10)12(15,16)17/h3-4H,1-2H3 |
| InChIKey | GINVNHWCIHYQGD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline?
The IUPAC name of 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline (CID 82766418) is 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline.
What is the SMILES notation for 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline?
The canonical SMILES for 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline is Cc1c(C(F)(F)F)nc2c(Br)ccc(C)c2c1Cl.
What is the InChIKey of 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline?
The InChIKey is GINVNHWCIHYQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrClF3N/c1-5-3-4-7(13)10-8(5)9(14)6(2)11(18-10)12(15,16)17/h3-4H,1-2H3.
What are the key properties of 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline?
8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline has a molecular weight of 338.55 g/mol, XLogP of 5.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4-chloro-3,5-dimethyl-2-(trifluoromethyl)quinoline is sourced from PubChem (CID 82766418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).