C13H14N2O3S — CID 82767208
1-cyano-N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanesulfonamide (PubChem CID 82767208) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-cyano-N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanesulfonamide.
| Compound Name | 1-cyano-N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 82767208 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-cyano-N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanesulfonamide |
| SMILES | Cc1ccc(C#CCCO)c(NS(=O)(=O)CC#N)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-11-5-6-12(4-2-3-8-16)13(10-11)15-19(17,18)9-7-14/h5-6,10,15-16H,3,8-9H2,1H3 |
| InChIKey | SEQHFYDWLAULHV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|