About 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide
2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide (PubChem CID 82768104) has the molecular formula C12H21F3N2O
and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide |
| PubChem CID | 82768104 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide |
| SMILES | CC1(C(=O)NCCCCC(F)(F)F)CCCC1N |
| InChI | InChI=1S/C12H21F3N2O/c1-11(6-4-5-9(11)16)10(18)17-8-3-2-7-12(13,14)15/h9H,2-8,16H2,1H3,(H,17,18) |
| InChIKey | FGHIPVPTCFOQKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The IUPAC name of 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide (CID 82768104) is 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide.
What is the SMILES notation for 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The canonical SMILES for 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide is CC1(C(=O)NCCCCC(F)(F)F)CCCC1N.
What is the InChIKey of 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The InChIKey is FGHIPVPTCFOQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O/c1-11(6-4-5-9(11)16)10(18)17-8-3-2-7-12(13,14)15/h9H,2-8,16H2,1H3,(H,17,18).
What are the key properties of 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide has a molecular weight of 266.31 g/mol, XLogP of 2.35, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-methyl-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 82768104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).