C15H16F2N2O — CID 82769634
N-[(5-fluoro-2-methoxyphenyl)-(5-fluoro-2-pyridinyl)methyl]ethanamine (PubChem CID 82769634) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is N-[(5-fluoro-2-methoxyphenyl)-(5-fluoro-2-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-fluoro-2-methoxyphenyl)-(5-fluoro-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82769634 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(5-fluoro-2-methoxyphenyl)-(5-fluoro-2-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)cn1)c1cc(F)ccc1OC |
| InChI | InChI=1S/C15H16F2N2O/c1-3-18-15(13-6-4-11(17)9-19-13)12-8-10(16)5-7-14(12)20-2/h4-9,15,18H,3H2,1-2H3 |
| InChIKey | ROYSCCDVSPTMLC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |