C12H15FO2S — CID 82769769
(5-fluoro-2-methoxyphenyl)-(thiolan-2-yl)methanol (PubChem CID 82769769) has the molecular formula C12H15FO2S and a molecular weight of 242.31 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)-(thiolan-2-yl)methanol.
| Compound Name | (5-fluoro-2-methoxyphenyl)-(thiolan-2-yl)methanol |
|---|---|
| PubChem CID | 82769769 |
| Molecular Formula | C12H15FO2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)-(thiolan-2-yl)methanol |
| SMILES | COc1ccc(F)cc1C(O)C1CCCS1 |
| InChI | InChI=1S/C12H15FO2S/c1-15-10-5-4-8(13)7-9(10)12(14)11-3-2-6-16-11/h4-5,7,11-12,14H,2-3,6H2,1H3 |
| InChIKey | WJNJYNFWJXFGFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |