C13H13N3O5 — CID 82769829
4-[3-(methylamino)-3-oxopropyl]-2,3-dioxo-1H-quinoxaline-6-carboxylic acid (PubChem CID 82769829) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-[3-(methylamino)-3-oxopropyl]-2,3-dioxo-1H-quinoxaline-6-carboxylic acid.
| Compound Name | 4-[3-(methylamino)-3-oxopropyl]-2,3-dioxo-1H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 82769829 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-[3-(methylamino)-3-oxopropyl]-2,3-dioxo-1H-quinoxaline-6-carboxylic acid |
| SMILES | CNC(=O)CCn1c(=O)c(=O)[nH]c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C13H13N3O5/c1-14-10(17)4-5-16-9-6-7(13(20)21)2-3-8(9)15-11(18)12(16)19/h2-3,6H,4-5H2,1H3,(H,14,17)(H,15,18)(H,20,21) |
| InChIKey | DPZDIQFUXOYLNW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|