C15H22ClNO3 — CID 82770188
ethyl 4-[1-(2-chlorophenyl)ethyl-methylamino]-3-hydroxybutanoate (PubChem CID 82770188) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 4-[1-(2-chlorophenyl)ethyl-methylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 4-[1-(2-chlorophenyl)ethyl-methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82770188 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 4-[1-(2-chlorophenyl)ethyl-methylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CN(C)C(C)c1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO3/c1-4-20-15(19)9-12(18)10-17(3)11(2)13-7-5-6-8-14(13)16/h5-8,11-12,18H,4,9-10H2,1-3H3 |
| InChIKey | RBWYXKXNZCXFHT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |