C13H15NO4 — CID 82770508
3-hydroxy-4-(4-oxo-2,3-dihydroquinolin-1-yl)butanoic acid (PubChem CID 82770508) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-hydroxy-4-(4-oxo-2,3-dihydroquinolin-1-yl)butanoic acid.
| Compound Name | 3-hydroxy-4-(4-oxo-2,3-dihydroquinolin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 82770508 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-hydroxy-4-(4-oxo-2,3-dihydroquinolin-1-yl)butanoic acid |
| SMILES | O=C(O)CC(O)CN1CCC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15NO4/c15-9(7-13(17)18)8-14-6-5-12(16)10-3-1-2-4-11(10)14/h1-4,9,15H,5-8H2,(H,17,18) |
| InChIKey | BRVUZZSGIMUDDC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |