C13H6Cl3N3O2 — CID 82770771
3-(2,4,5-trichlorophenyl)benzotriazole-5-carboxylic acid (PubChem CID 82770771) has the molecular formula C13H6Cl3N3O2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 3-(2,4,5-trichlorophenyl)benzotriazole-5-carboxylic acid.
| Compound Name | 3-(2,4,5-trichlorophenyl)benzotriazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82770771 |
| Molecular Formula | C13H6Cl3N3O2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 3-(2,4,5-trichlorophenyl)benzotriazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nnn(-c3cc(Cl)c(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C13H6Cl3N3O2/c14-7-4-9(16)11(5-8(7)15)19-12-3-6(13(20)21)1-2-10(12)17-18-19/h1-5H,(H,20,21) |
| InChIKey | QAYUHQBBKUKOSE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|