3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid

C14H9F2N3O2 — CID 82770777

IUPAC3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nnn(Cc3ccc(F)c(F)c3)c2c1
InChIInChI=1S/C14H9F2N3O2/c15-10-3-1-8(5-11(10)16)7-19-13-6-9(14(20)21)2-4-12(13)17-18-19/h1-6H,7H2,(H,20,21)
InChIKeyQHCUBIOHFCJBDV-UHFFFAOYSA-N
MW289.24 g/mol
LogP2.46
Rot. Bonds3

About 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid

3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid (PubChem CID 82770777) has the molecular formula C14H9F2N3O2 and a molecular weight of 289.24 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid
PubChem CID82770777
Molecular FormulaC14H9F2N3O2
Molecular Weight289.24 g/mol
Exact Mass289.07
IUPAC Name3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nnn(Cc3ccc(F)c(F)c3)c2c1
InChIInChI=1S/C14H9F2N3O2/c15-10-3-1-8(5-11(10)16)7-19-13-6-9(14(20)21)2-4-12(13)17-18-19/h1-6H,7H2,(H,20,21)
InChIKeyQHCUBIOHFCJBDV-UHFFFAOYSA-N
XLogP2.46
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.24
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid?
The IUPAC name of 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid (CID 82770777) is 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid.
What is the SMILES notation for 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid?
The canonical SMILES for 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid is O=C(O)c1ccc2nnn(Cc3ccc(F)c(F)c3)c2c1.
What is the InChIKey of 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid?
The InChIKey is QHCUBIOHFCJBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2N3O2/c15-10-3-1-8(5-11(10)16)7-19-13-6-9(14(20)21)2-4-12(13)17-18-19/h1-6H,7H2,(H,20,21).
What are the key properties of 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid?
3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid has a molecular weight of 289.24 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-difluorophenyl)methyl]benzotriazole-5-carboxylic acid is sourced from PubChem (CID 82770777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).