C11H4Cl2F2N4 — CID 82771314
8-chloro-3-(4-chloro-2,5-difluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 82771314) has the molecular formula C11H4Cl2F2N4 and a molecular weight of 301.08 g/mol. Its IUPAC name is 8-chloro-3-(4-chloro-2,5-difluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-(4-chloro-2,5-difluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 82771314 |
| Molecular Formula | C11H4Cl2F2N4 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 8-chloro-3-(4-chloro-2,5-difluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Fc1cc(-c2nnc3c(Cl)nccn23)c(F)cc1Cl |
| InChI | InChI=1S/C11H4Cl2F2N4/c12-6-4-7(14)5(3-8(6)15)10-17-18-11-9(13)16-1-2-19(10)11/h1-4H |
| InChIKey | QAQLTVWAQBXNAL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|