C15H11Br2ClF2O — CID 82772679
1-[bromo-(2-bromo-4-ethoxyphenyl)methyl]-4-chloro-2,5-difluorobenzene (PubChem CID 82772679) has the molecular formula C15H11Br2ClF2O and a molecular weight of 440.51 g/mol. Its IUPAC name is 1-[bromo-(2-bromo-4-ethoxyphenyl)methyl]-4-chloro-2,5-difluorobenzene.
| Compound Name | 1-[bromo-(2-bromo-4-ethoxyphenyl)methyl]-4-chloro-2,5-difluorobenzene |
|---|---|
| PubChem CID | 82772679 |
| Molecular Formula | C15H11Br2ClF2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | 1-[bromo-(2-bromo-4-ethoxyphenyl)methyl]-4-chloro-2,5-difluorobenzene |
| SMILES | CCOc1ccc(C(Br)c2cc(F)c(Cl)cc2F)c(Br)c1 |
| InChI | InChI=1S/C15H11Br2ClF2O/c1-2-21-8-3-4-9(11(16)5-8)15(17)10-6-14(20)12(18)7-13(10)19/h3-7,15H,2H2,1H3 |
| InChIKey | YUJLTPBIZPCCSW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|