C13H14ClF2N3O — CID 82772686
3-[5-(4-chloro-2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine (PubChem CID 82772686) has the molecular formula C13H14ClF2N3O and a molecular weight of 301.72 g/mol. Its IUPAC name is 3-[5-(4-chloro-2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine.
| Compound Name | 3-[5-(4-chloro-2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine |
|---|---|
| PubChem CID | 82772686 |
| Molecular Formula | C13H14ClF2N3O |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[5-(4-chloro-2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine |
| SMILES | CCC(N)(CC)c1noc(-c2cc(F)c(Cl)cc2F)n1 |
| InChI | InChI=1S/C13H14ClF2N3O/c1-3-13(17,4-2)12-18-11(20-19-12)7-5-10(16)8(14)6-9(7)15/h5-6H,3-4,17H2,1-2H3 |
| InChIKey | QOJRRJFYSOQDFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|