C12H9BrClF2N3 — CID 82773403
3-(bromomethyl)-5-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole (PubChem CID 82773403) has the molecular formula C12H9BrClF2N3 and a molecular weight of 348.58 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 82773403 |
| Molecular Formula | C12H9BrClF2N3 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 3-(bromomethyl)-5-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole |
| SMILES | Fc1cc(-c2nnc(CBr)n2C2CC2)c(F)cc1Cl |
| InChI | InChI=1S/C12H9BrClF2N3/c13-5-11-17-18-12(19(11)6-1-2-6)7-3-10(16)8(14)4-9(7)15/h3-4,6H,1-2,5H2 |
| InChIKey | UMGAMCNJWASOJP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|