C11H8ClF2N3 — CID 82773685
3-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole (PubChem CID 82773685) has the molecular formula C11H8ClF2N3 and a molecular weight of 255.66 g/mol. Its IUPAC name is 3-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole.
| Compound Name | 3-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 82773685 |
| Molecular Formula | C11H8ClF2N3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 3-(4-chloro-2,5-difluorophenyl)-4-cyclopropyl-1,2,4-triazole |
| SMILES | Fc1cc(-c2nncn2C2CC2)c(F)cc1Cl |
| InChI | InChI=1S/C11H8ClF2N3/c12-8-4-9(13)7(3-10(8)14)11-16-15-5-17(11)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | OOCONGKXNJMNNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|