C16H19BrClNS — CID 82774195
N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-thiophen-2-ylbutan-1-amine (PubChem CID 82774195) has the molecular formula C16H19BrClNS and a molecular weight of 372.76 g/mol. Its IUPAC name is N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-thiophen-2-ylbutan-1-amine.
| Compound Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 82774195 |
| Molecular Formula | C16H19BrClNS |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-thiophen-2-ylbutan-1-amine |
| SMILES | CCCC(NC(C)c1ccc(Br)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C16H19BrClNS/c1-3-5-15(16-6-4-9-20-16)19-11(2)13-8-7-12(17)10-14(13)18/h4,6-11,15,19H,3,5H2,1-2H3 |
| InChIKey | BUUUPTFBLCNNDI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |